sergiotorrez33 sergiotorrez33
  • 25-06-2020
  • Mathematics
contestada

What is the equation of the line that is perpendicular to the
given line and has an x-intercept of 6?
y=-3x+8
O y=-3x + 6
O y=-x-8
O y=x-6

Respuesta :

jbiain jbiain
  • 30-06-2020

Answer:

y=x-6

Step-by-step explanation:

The x-intercept is found replacing y = 0, as follows:

Function: y = -3x + 8

x-intercept:

0 = -3x + 8  

3x = 8

x = 8/3

Function: y = -3x + 6

x-intercept:

0 = -3x + 6

3x = 6

x = 6/3 = 2

Function: y = -x - 8  

x-intercept:

0 = -x - 8  

x = -8

Function: y = x - 6

x-intercept:

0 = x - 6

x = 6

The last option is the only one in which x-intercept is x = 6.

Answer Link

Otras preguntas

In a survey of 1000 adults, 170 indicated that they were not confident that they will have enough saved to last through retirement. Write the fraction, in lowe
Mikael runs with a speed of 3 m/s for 45 seconds. How far does Mikael run?
Write the equation of the line that passes through the given points. (0,- 4) and (2,3)The equation of the line is( )​
helppp plzzzzzzzzzzz​
which is the correct method to add rational numbers?A a/b+c/b=ac/b B a/b+c/b=a+c/b
KOH + HNO3 equals HOH + KNO what type of reaction is this​
not sure if anyone knows this but if you do please help :)
What type of figurative language is "It was a wonder Fred didn't shake his arm off!" from A Christmas Carol?
Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2
3. In the fig. AD = DC and AB = BC. Prove that ΔADB = ΔCDB​